C15H12BrN3O3 — CID 162438151
ethyl 2-[(Z)-(5-bromo-2-oxo-1H-pyrrolo[2,3-b]pyridin-3-ylidene)methyl]-1H-pyrrole-3-carboxylate (PubChem CID 162438151) has the molecular formula C15H12BrN3O3 and a molecular weight of 362.18 g/mol. Its IUPAC name is ethyl 2-[(Z)-(5-bromo-2-oxo-1H-pyrrolo[2,3-b]pyridin-3-ylidene)methyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2-[(Z)-(5-bromo-2-oxo-1H-pyrrolo[2,3-b]pyridin-3-ylidene)methyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 162438151 |
| Molecular Formula | C15H12BrN3O3 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | ethyl 2-[(Z)-(5-bromo-2-oxo-1H-pyrrolo[2,3-b]pyridin-3-ylidene)methyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc[nH]c1/C=C1\C(=O)Nc2ncc(Br)cc21 |
| InChI | InChI=1S/C15H12BrN3O3/c1-2-22-15(21)9-3-4-17-12(9)6-11-10-5-8(16)7-18-13(10)19-14(11)20/h3-7,17H,2H2,1H3,(H,18,19,20)/b11-6- |
| InChIKey | MPUQCHQGDYSPDL-WDZFZDKYSA-N |
| XLogP | 2.84 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|