C18H18N2O4 — CID 57120196
3-[1-[(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-4-methylpyrrol-3-yl]propanoic acid (PubChem CID 57120196) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-[1-[(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-4-methylpyrrol-3-yl]propanoic acid.
| Compound Name | 3-[1-[(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-4-methylpyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 57120196 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-[1-[(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-4-methylpyrrol-3-yl]propanoic acid |
| SMILES | COc1ccc2c(c1)C(=Cn1cc(C)c(CCC(=O)O)c1)C(=O)N2 |
| InChI | InChI=1S/C18H18N2O4/c1-11-8-20(9-12(11)3-6-17(21)22)10-15-14-7-13(24-2)4-5-16(14)19-18(15)23/h4-5,7-10H,3,6H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | QCPLDXKAAAVHFX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|