C25H22N4O4 — CID 140665483
1-N'-(4-methoxyphenyl)-1-N'-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 140665483) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-N'-(4-methoxyphenyl)-1-N'-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-methoxyphenyl)-1-N'-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 140665483 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 1-N'-(4-methoxyphenyl)-1-N'-[2-oxo-3-(1H-pyrrol-2-ylmethylidene)-1H-indol-6-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(N(C(=O)C2(C(N)=O)CC2)c2ccc3c(c2)NC(=O)C3=Cc2ccc[nH]2)cc1 |
| InChI | InChI=1S/C25H22N4O4/c1-33-18-7-4-16(5-8-18)29(24(32)25(10-11-25)23(26)31)17-6-9-19-20(13-15-3-2-12-27-15)22(30)28-21(19)14-17/h2-9,12-14,27H,10-11H2,1H3,(H2,26,31)(H,28,30) |
| InChIKey | RTQQMVOJAGXXNN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|