C14H15ClO3S — CID 134395742
tert-butyl 5-chloro-6-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 134395742) has the molecular formula C14H15ClO3S and a molecular weight of 298.79 g/mol. Its IUPAC name is tert-butyl 5-chloro-6-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | tert-butyl 5-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 134395742 |
| Molecular Formula | C14H15ClO3S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | tert-butyl 5-chloro-6-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COc1cc2sc(C(=O)OC(C)(C)C)cc2cc1Cl |
| InChI | InChI=1S/C14H15ClO3S/c1-14(2,3)18-13(16)12-6-8-5-9(15)10(17-4)7-11(8)19-12/h5-7H,1-4H3 |
| InChIKey | CUIXIORVNZZIGB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |