C21H28O3S — CID 142319741
5,6-dimethoxy-2-[(2E,5Z)-5-[(2-methylpropan-2-yl)oxy]hepta-2,5-dien-3-yl]-1-benzothiophene (PubChem CID 142319741) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is 5,6-dimethoxy-2-[(2E,5Z)-5-[(2-methylpropan-2-yl)oxy]hepta-2,5-dien-3-yl]-1-benzothiophene.
| Compound Name | 5,6-dimethoxy-2-[(2E,5Z)-5-[(2-methylpropan-2-yl)oxy]hepta-2,5-dien-3-yl]-1-benzothiophene |
|---|---|
| PubChem CID | 142319741 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 5,6-dimethoxy-2-[(2E,5Z)-5-[(2-methylpropan-2-yl)oxy]hepta-2,5-dien-3-yl]-1-benzothiophene |
| SMILES | C/C=C(/C/C(=C\C)c1cc2cc(OC)c(OC)cc2s1)OC(C)(C)C |
| InChI | InChI=1S/C21H28O3S/c1-8-14(10-16(9-2)24-21(3,4)5)19-12-15-11-17(22-6)18(23-7)13-20(15)25-19/h8-9,11-13H,10H2,1-7H3/b14-8+,16-9- |
| InChIKey | AOGZMJRBHBJJBA-CUTGRJBWSA-N |
| XLogP | 6.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|