About 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone
1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone (PubChem CID 45104331) has the molecular formula C13H14O4S2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone.
Molecular Properties
| Compound Name | 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone |
| PubChem CID | 45104331 |
| Molecular Formula | C13H14O4S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone |
| SMILES | COc1cc2cc(C(=O)CS(C)=O)sc2cc1OC |
| InChI | InChI=1S/C13H14O4S2/c1-16-10-4-8-5-13(9(14)7-19(3)15)18-12(8)6-11(10)17-2/h4-6H,7H2,1-3H3 |
| InChIKey | QOEQTXGYMDRABY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone?
The IUPAC name of 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone (CID 45104331) is 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone.
What is the SMILES notation for 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone?
The canonical SMILES for 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone is COc1cc2cc(C(=O)CS(C)=O)sc2cc1OC.
What is the InChIKey of 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone?
The InChIKey is QOEQTXGYMDRABY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4S2/c1-16-10-4-8-5-13(9(14)7-19(3)15)18-12(8)6-11(10)17-2/h4-6H,7H2,1-3H3.
What are the key properties of 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone?
1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone has a molecular weight of 298.39 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methylsulfinylethanone is sourced from PubChem (CID 45104331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).