C11H10O5S — CID 69363349
(5,6-dimethoxy-1-benzothiophen-2-yl) hydrogen carbonate (PubChem CID 69363349) has the molecular formula C11H10O5S and a molecular weight of 254.26 g/mol. Its IUPAC name is (5,6-dimethoxy-1-benzothiophen-2-yl) hydrogen carbonate.
| Compound Name | (5,6-dimethoxy-1-benzothiophen-2-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 69363349 |
| Molecular Formula | C11H10O5S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | (5,6-dimethoxy-1-benzothiophen-2-yl) hydrogen carbonate |
| SMILES | COc1cc2cc(OC(=O)O)sc2cc1OC |
| InChI | InChI=1S/C11H10O5S/c1-14-7-3-6-4-10(16-11(12)13)17-9(6)5-8(7)15-2/h3-5H,1-2H3,(H,12,13) |
| InChIKey | QPLNMBVOXHJAIS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |