C23H20O4S — CID 25058340
4-[5,6-dimethoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]phenol (PubChem CID 25058340) has the molecular formula C23H20O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-[5,6-dimethoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]phenol.
| Compound Name | 4-[5,6-dimethoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]phenol |
|---|---|
| PubChem CID | 25058340 |
| Molecular Formula | C23H20O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[5,6-dimethoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]phenol |
| SMILES | COc1ccc(-c2sc3cc(OC)c(OC)cc3c2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H20O4S/c1-25-17-10-6-15(7-11-17)23-22(14-4-8-16(24)9-5-14)18-12-19(26-2)20(27-3)13-21(18)28-23/h4-13,24H,1-3H3 |
| InChIKey | URSCNRXRKHZAJJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |