C19H18O4S — CID 11186928
6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophen-4-ol (PubChem CID 11186928) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophen-4-ol.
| Compound Name | 6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 11186928 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophen-4-ol |
| SMILES | COc1cc(/C=C\c2cc(O)c3ccsc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H18O4S/c1-21-16-9-13(10-17(22-2)19(16)23-3)5-4-12-8-15(20)14-6-7-24-18(14)11-12/h4-11,20H,1-3H3/b5-4- |
| InChIKey | PEXHXKNLHNMUNN-PLNGDYQASA-N |
| XLogP | 4.80 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|