C17H20O6S — CID 139531531
4-[5-(3-hydroxypropoxy)-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid (PubChem CID 139531531) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is 4-[5-(3-hydroxypropoxy)-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid.
| Compound Name | 4-[5-(3-hydroxypropoxy)-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139531531 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 4-[5-(3-hydroxypropoxy)-6-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
| SMILES | COc1cc2sc(C(=O)CC(C)C(=O)O)cc2cc1OCCCO |
| InChI | InChI=1S/C17H20O6S/c1-10(17(20)21)6-12(19)16-8-11-7-14(23-5-3-4-18)13(22-2)9-15(11)24-16/h7-10,18H,3-6H2,1-2H3,(H,20,21) |
| InChIKey | JBNGIGYBJYOIEI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|