C20H25BrO5S — CID 139531487
(2S)-4-[6-(6-bromohexoxy)-5-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid (PubChem CID 139531487) has the molecular formula C20H25BrO5S and a molecular weight of 457.39 g/mol. Its IUPAC name is (2S)-4-[6-(6-bromohexoxy)-5-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid.
| Compound Name | (2S)-4-[6-(6-bromohexoxy)-5-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139531487 |
| Molecular Formula | C20H25BrO5S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (2S)-4-[6-(6-bromohexoxy)-5-methoxy-1-benzothiophen-2-yl]-2-methyl-4-oxobutanoic acid |
| SMILES | COc1cc2cc(C(=O)C[C@H](C)C(=O)O)sc2cc1OCCCCCCBr |
| InChI | InChI=1S/C20H25BrO5S/c1-13(20(23)24)9-15(22)19-11-14-10-16(25-2)17(12-18(14)27-19)26-8-6-4-3-5-7-21/h10-13H,3-9H2,1-2H3,(H,23,24)/t13-/m0/s1 |
| InChIKey | SGSHEMQAXZECHT-ZDUSSCGKSA-N |
| XLogP | 5.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|