About (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane
(4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane (PubChem CID 142319805) has the molecular formula C20H29NO5S2
and a molecular weight of 427.59 g/mol. Its IUPAC name is (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane.
Molecular Properties
| Compound Name | (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane |
| PubChem CID | 142319805 |
| Molecular Formula | C20H29NO5S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane |
| SMILES | CC.COc1cc2cc(C(=O)CCC(=O)OC(CS)CCN)sc2cc1OC |
| InChI | InChI=1S/C18H23NO5S2.C2H6/c1-22-14-7-11-8-17(26-16(11)9-15(14)23-2)13(20)3-4-18(21)24-12(10-25)5-6-19;1-2/h7-9,12,25H,3-6,10,19H2,1-2H3;1-2H3 |
| InChIKey | HVARTIAAYGXKQB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane?
The IUPAC name of (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane (CID 142319805) is (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane.
What is the SMILES notation for (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane?
The canonical SMILES for (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane is CC.COc1cc2cc(C(=O)CCC(=O)OC(CS)CCN)sc2cc1OC.
What is the InChIKey of (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane?
The InChIKey is HVARTIAAYGXKQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO5S2.C2H6/c1-22-14-7-11-8-17(26-16(11)9-15(14)23-2)13(20)3-4-18(21)24-12(10-25)5-6-19;1-2/h7-9,12,25H,3-6,10,19H2,1-2H3;1-2H3.
What are the key properties of (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane?
(4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane has a molecular weight of 427.59 g/mol, XLogP of 4.10, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane is sourced from PubChem (CID 142319805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).