C20H29NO5S2 — CID 142319805
(4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane (PubChem CID 142319805) has the molecular formula C20H29NO5S2 and a molecular weight of 427.59 g/mol. Its IUPAC name is (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane.
| Compound Name | (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane |
|---|---|
| PubChem CID | 142319805 |
| Molecular Formula | C20H29NO5S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (4-amino-1-sulfanylbutan-2-yl) 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoate;ethane |
| SMILES | CC.COc1cc2cc(C(=O)CCC(=O)OC(CS)CCN)sc2cc1OC |
| InChI | InChI=1S/C18H23NO5S2.C2H6/c1-22-14-7-11-8-17(26-16(11)9-15(14)23-2)13(20)3-4-18(21)24-12(10-25)5-6-19;1-2/h7-9,12,25H,3-6,10,19H2,1-2H3;1-2H3 |
| InChIKey | HVARTIAAYGXKQB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|