C17H18O4S — CID 134391939
ethyl 4-(6-ethenyl-5-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate (PubChem CID 134391939) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is ethyl 4-(6-ethenyl-5-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate.
| Compound Name | ethyl 4-(6-ethenyl-5-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 134391939 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | ethyl 4-(6-ethenyl-5-methoxy-1-benzothiophen-2-yl)-4-oxobutanoate |
| SMILES | C=Cc1cc2sc(C(=O)CCC(=O)OCC)cc2cc1OC |
| InChI | InChI=1S/C17H18O4S/c1-4-11-9-15-12(8-14(11)20-3)10-16(22-15)13(18)6-7-17(19)21-5-2/h4,8-10H,1,5-7H2,2-3H3 |
| InChIKey | WWQXMSJSMBWMNO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |