C23H30O7S — CID 146226165
2-(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-3-(2,2-dimethylpropoxycarbonyl)hexanoic acid (PubChem CID 146226165) has the molecular formula C23H30O7S and a molecular weight of 450.55 g/mol. Its IUPAC name is 2-(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-3-(2,2-dimethylpropoxycarbonyl)hexanoic acid.
| Compound Name | 2-(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-3-(2,2-dimethylpropoxycarbonyl)hexanoic acid |
|---|---|
| PubChem CID | 146226165 |
| Molecular Formula | C23H30O7S |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-3-(2,2-dimethylpropoxycarbonyl)hexanoic acid |
| SMILES | CCCC(C(=O)OCC(C)(C)C)C(C(=O)O)C(=O)c1cc2cc(OC)c(OC)cc2s1 |
| InChI | InChI=1S/C23H30O7S/c1-7-8-14(22(27)30-12-23(2,3)4)19(21(25)26)20(24)18-10-13-9-15(28-5)16(29-6)11-17(13)31-18/h9-11,14,19H,7-8,12H2,1-6H3,(H,25,26) |
| InChIKey | BRRLCUOJWMYCKP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|