About 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid
2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid (PubChem CID 147393696) has the molecular formula C19H25NO5S
and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid |
| PubChem CID | 147393696 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid |
| SMILES | COc1cc2cc(C(=O)N(CCCC(C)C)CC(=O)O)sc2cc1OC |
| InChI | InChI=1S/C19H25NO5S/c1-12(2)6-5-7-20(11-18(21)22)19(23)17-9-13-8-14(24-3)15(25-4)10-16(13)26-17/h8-10,12H,5-7,11H2,1-4H3,(H,21,22) |
| InChIKey | DNJQXVYSKQJLAV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid?
The IUPAC name of 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid (CID 147393696) is 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid.
What is the SMILES notation for 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid?
The canonical SMILES for 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid is COc1cc2cc(C(=O)N(CCCC(C)C)CC(=O)O)sc2cc1OC.
What is the InChIKey of 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid?
The InChIKey is DNJQXVYSKQJLAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO5S/c1-12(2)6-5-7-20(11-18(21)22)19(23)17-9-13-8-14(24-3)15(25-4)10-16(13)26-17/h8-10,12H,5-7,11H2,1-4H3,(H,21,22).
What are the key properties of 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid?
2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid has a molecular weight of 379.48 g/mol, XLogP of 3.88, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dimethoxy-1-benzothiophene-2-carbonyl)-(4-methylpentyl)amino]acetic acid is sourced from PubChem (CID 147393696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).