C14H14N2O6S — CID 119189388
2-[2-methoxyethyl-(5-nitro-1-benzothiophene-2-carbonyl)amino]acetic acid (PubChem CID 119189388) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-[2-methoxyethyl-(5-nitro-1-benzothiophene-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[2-methoxyethyl-(5-nitro-1-benzothiophene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 119189388 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-[2-methoxyethyl-(5-nitro-1-benzothiophene-2-carbonyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C14H14N2O6S/c1-22-5-4-15(8-13(17)18)14(19)12-7-9-6-10(16(20)21)2-3-11(9)23-12/h2-3,6-7H,4-5,8H2,1H3,(H,17,18) |
| InChIKey | JSLZYWQPQLCPOZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|