C21H17NO3S — CID 54352801
3-[(4,5-dimethoxy-2-thiophen-2-ylphenyl)methylidene]-1H-indol-2-one (PubChem CID 54352801) has the molecular formula C21H17NO3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-[(4,5-dimethoxy-2-thiophen-2-ylphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 3-[(4,5-dimethoxy-2-thiophen-2-ylphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 54352801 |
| Molecular Formula | C21H17NO3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-[(4,5-dimethoxy-2-thiophen-2-ylphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc(C=C2C(=O)Nc3ccccc32)c(-c2cccs2)cc1OC |
| InChI | InChI=1S/C21H17NO3S/c1-24-18-11-13(15(12-19(18)25-2)20-8-5-9-26-20)10-16-14-6-3-4-7-17(14)22-21(16)23/h3-12H,1-2H3,(H,22,23) |
| InChIKey | UGYJYHZSRGMFCW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|