C20H20N2O5 — CID 155758920
N-[2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-5-yl]acetamide (PubChem CID 155758920) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-5-yl]acetamide.
| Compound Name | N-[2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-5-yl]acetamide |
|---|---|
| PubChem CID | 155758920 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-5-yl]acetamide |
| SMILES | COc1cc(C=C2C(=O)Nc3ccc(NC(C)=O)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O5/c1-11(23)21-13-5-6-16-14(10-13)15(20(24)22-16)7-12-8-17(25-2)19(27-4)18(9-12)26-3/h5-10H,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | VIEPPENHRPHOFP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|