C21H18ClNO5 — CID 74221211
(3E)-5-chloro-3-[(E)-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enylidene]-1H-indol-2-one (PubChem CID 74221211) has the molecular formula C21H18ClNO5 and a molecular weight of 399.83 g/mol. Its IUPAC name is (3E)-5-chloro-3-[(E)-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-chloro-3-[(E)-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 74221211 |
| Molecular Formula | C21H18ClNO5 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (3E)-5-chloro-3-[(E)-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C2/C(=O)Nc3ccc(Cl)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C21H18ClNO5/c1-26-18-8-12(9-19(27-2)20(18)28-3)4-6-14(24)11-16-15-10-13(22)5-7-17(15)23-21(16)25/h4-11H,1-3H3,(H,23,25)/b6-4+,16-11+ |
| InChIKey | JANQEGXBWSKGGU-WAKFUBCGSA-N |
| XLogP | 3.98 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|