C19H15NO4 — CID 123982841
3-[4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enylidene]-1H-indol-2-one (PubChem CID 123982841) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is 3-[4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enylidene]-1H-indol-2-one.
| Compound Name | 3-[4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 123982841 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-[4-(4-hydroxy-3-methoxyphenyl)-2-oxobut-3-enylidene]-1H-indol-2-one |
| SMILES | COc1cc(C=CC(=O)C=C2C(=O)Nc3ccccc32)ccc1O |
| InChI | InChI=1S/C19H15NO4/c1-24-18-10-12(7-9-17(18)22)6-8-13(21)11-15-14-4-2-3-5-16(14)20-19(15)23/h2-11,22H,1H3,(H,20,23) |
| InChIKey | KAHMHPVCWCJRPE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|