C21H19NO5 — CID 118314797
(3E)-3-[(E)-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enylidene]-1H-indol-2-one (PubChem CID 118314797) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (3E)-3-[(E)-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[(E)-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 118314797 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (3E)-3-[(E)-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C2/C(=O)Nc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C21H19NO5/c1-25-18-10-13(11-19(26-2)20(18)27-3)8-9-14(23)12-16-15-6-4-5-7-17(15)22-21(16)24/h4-12H,1-3H3,(H,22,24)/b9-8+,16-12+ |
| InChIKey | FWWMDDIYYWFOOO-LFZNACJFSA-N |
| XLogP | 3.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|