C21H23NO4S — CID 71682375
(1E,4E)-1-anilino-1-methylsulfanyl-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one (PubChem CID 71682375) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is (1E,4E)-1-anilino-1-methylsulfanyl-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-anilino-1-methylsulfanyl-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 71682375 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (1E,4E)-1-anilino-1-methylsulfanyl-5-(3,4,5-trimethoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C(\Nc2ccccc2)SC)cc(OC)c1OC |
| InChI | InChI=1S/C21H23NO4S/c1-24-18-12-15(13-19(25-2)21(18)26-3)10-11-17(23)14-20(27-4)22-16-8-6-5-7-9-16/h5-14,22H,1-4H3/b11-10+,20-14+ |
| InChIKey | ANTJMCLNSKHFEM-KCIHDACCSA-N |
| XLogP | 4.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|