C25H29N3O6 — CID 162672252
3-morpholin-4-yl-N-[(3E)-2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-5-yl]propanamide (PubChem CID 162672252) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[(3E)-2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-5-yl]propanamide.
| Compound Name | 3-morpholin-4-yl-N-[(3E)-2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-5-yl]propanamide |
|---|---|
| PubChem CID | 162672252 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-morpholin-4-yl-N-[(3E)-2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indol-5-yl]propanamide |
| SMILES | COc1cc(/C=C2/C(=O)Nc3ccc(NC(=O)CCN4CCOCC4)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C25H29N3O6/c1-31-21-13-16(14-22(32-2)24(21)33-3)12-19-18-15-17(4-5-20(18)27-25(19)30)26-23(29)6-7-28-8-10-34-11-9-28/h4-5,12-15H,6-11H2,1-3H3,(H,26,29)(H,27,30)/b19-12+ |
| InChIKey | ISIGDXSTQYFFDW-XDHOZWIPSA-N |
| XLogP | 2.87 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|