C25H25N3O2S — CID 177044482
N-[(3E)-3-(1-benzothiophen-2-ylmethylidene)-2-oxo-1H-indol-5-yl]-3-piperidin-1-ylpropanamide (PubChem CID 177044482) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[(3E)-3-(1-benzothiophen-2-ylmethylidene)-2-oxo-1H-indol-5-yl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[(3E)-3-(1-benzothiophen-2-ylmethylidene)-2-oxo-1H-indol-5-yl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 177044482 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[(3E)-3-(1-benzothiophen-2-ylmethylidene)-2-oxo-1H-indol-5-yl]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)Nc1ccc2c(c1)/C(=C\c1cc3ccccc3s1)C(=O)N2 |
| InChI | InChI=1S/C25H25N3O2S/c29-24(10-13-28-11-4-1-5-12-28)26-18-8-9-22-20(15-18)21(25(30)27-22)16-19-14-17-6-2-3-7-23(17)31-19/h2-3,6-9,14-16H,1,4-5,10-13H2,(H,26,29)(H,27,30)/b21-16+ |
| InChIKey | RFTOZTKCKMKBGF-LTGZKZEYSA-N |
| XLogP | 5.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|