C30H24F3N3O3S — CID 57086816
2-oxo-3-[(4-phenyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide (PubChem CID 57086816) has the molecular formula C30H24F3N3O3S and a molecular weight of 563.60 g/mol. Its IUPAC name is 2-oxo-3-[(4-phenyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide.
| Compound Name | 2-oxo-3-[(4-phenyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57086816 |
| Molecular Formula | C30H24F3N3O3S |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 2-oxo-3-[(4-phenyl-4,5,6,7-tetrahydro-1H-indol-2-yl)methylidene]-N-[4-(trifluoromethyl)phenyl]-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3)cc2C1=Cc1cc2c([nH]1)CCCC2c1ccccc1 |
| InChI | InChI=1S/C30H24F3N3O3S/c31-30(32,33)19-9-11-20(12-10-19)36-40(38,39)22-13-14-28-25(17-22)26(29(37)35-28)16-21-15-24-23(7-4-8-27(24)34-21)18-5-2-1-3-6-18/h1-3,5-6,9-17,23,34,36H,4,7-8H2,(H,35,37) |
| InChIKey | DPNZLZGRSSZSTJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|