C17H14ClN3O6S — CID 57170707
3-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide (PubChem CID 57170707) has the molecular formula C17H14ClN3O6S and a molecular weight of 423.83 g/mol. Its IUPAC name is 3-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | 3-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 57170707 |
| Molecular Formula | C17H14ClN3O6S |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 3-[[3-(chloromethyl)-2-hydroxy-5-nitrophenyl]methylidene]-N-methyl-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)C(=Cc1cc([N+](=O)[O-])cc(CCl)c1O)C(=O)N2 |
| InChI | InChI=1S/C17H14ClN3O6S/c1-19-28(26,27)12-2-3-15-13(7-12)14(17(23)20-15)6-9-4-11(21(24)25)5-10(8-18)16(9)22/h2-7,19,22H,8H2,1H3,(H,20,23) |
| InChIKey | URIMHNFHWDUYJZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|