C21H17NO4S — CID 87504991
3-[(3-ethylazulen-1-yl)methylidene]-2-oxo-1H-indole-5-sulfonic acid (PubChem CID 87504991) has the molecular formula C21H17NO4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 3-[(3-ethylazulen-1-yl)methylidene]-2-oxo-1H-indole-5-sulfonic acid.
| Compound Name | 3-[(3-ethylazulen-1-yl)methylidene]-2-oxo-1H-indole-5-sulfonic acid |
|---|---|
| PubChem CID | 87504991 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-[(3-ethylazulen-1-yl)methylidene]-2-oxo-1H-indole-5-sulfonic acid |
| SMILES | CCc1cc(C=C2C(=O)Nc3ccc(S(=O)(=O)O)cc32)c2cccccc1-2 |
| InChI | InChI=1S/C21H17NO4S/c1-2-13-10-14(17-7-5-3-4-6-16(13)17)11-19-18-12-15(27(24,25)26)8-9-20(18)22-21(19)23/h3-12H,2H2,1H3,(H,22,23)(H,24,25,26) |
| InChIKey | CPYBPWLJSSQGMF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|