C18H16N2O4S — CID 60512344
(3E)-2-oxo-3-[(2-prop-2-enoxyphenyl)methylidene]-1H-indole-5-sulfonamide (PubChem CID 60512344) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is (3E)-2-oxo-3-[(2-prop-2-enoxyphenyl)methylidene]-1H-indole-5-sulfonamide.
| Compound Name | (3E)-2-oxo-3-[(2-prop-2-enoxyphenyl)methylidene]-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 60512344 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (3E)-2-oxo-3-[(2-prop-2-enoxyphenyl)methylidene]-1H-indole-5-sulfonamide |
| SMILES | C=CCOc1ccccc1/C=C1/C(=O)Nc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C18H16N2O4S/c1-2-9-24-17-6-4-3-5-12(17)10-15-14-11-13(25(19,22)23)7-8-16(14)20-18(15)21/h2-8,10-11H,1,9H2,(H,20,21)(H2,19,22,23)/b15-10+ |
| InChIKey | KABJLGVHUSFQRL-XNTDXEJSSA-N |
| XLogP | 2.39 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|