C18H14N2O5S — CID 60512254
(3E)-3-[(7-methoxy-1-benzofuran-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 60512254) has the molecular formula C18H14N2O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is (3E)-3-[(7-methoxy-1-benzofuran-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | (3E)-3-[(7-methoxy-1-benzofuran-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 60512254 |
| Molecular Formula | C18H14N2O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | (3E)-3-[(7-methoxy-1-benzofuran-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | COc1cccc2cc(/C=C3/C(=O)Nc4ccc(S(N)(=O)=O)cc43)oc12 |
| InChI | InChI=1S/C18H14N2O5S/c1-24-16-4-2-3-10-7-11(25-17(10)16)8-14-13-9-12(26(19,22)23)5-6-15(13)20-18(14)21/h2-9H,1H3,(H,20,21)(H2,19,22,23)/b14-8+ |
| InChIKey | PVYGALVLEUZFGV-RIYZIHGNSA-N |
| XLogP | 2.58 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|