C14H11N3O5S2 — CID 56979807
N-methyl-3-[(5-nitrothiophen-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 56979807) has the molecular formula C14H11N3O5S2 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-methyl-3-[(5-nitrothiophen-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | N-methyl-3-[(5-nitrothiophen-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 56979807 |
| Molecular Formula | C14H11N3O5S2 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-methyl-3-[(5-nitrothiophen-2-yl)methylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)C(=Cc1ccc([N+](=O)[O-])s1)C(=O)N2 |
| InChI | InChI=1S/C14H11N3O5S2/c1-15-24(21,22)9-3-4-12-10(7-9)11(14(18)16-12)6-8-2-5-13(23-8)17(19)20/h2-7,15H,1H3,(H,16,18) |
| InChIKey | NADGCDLJCKAFAW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|