C19H13N3O5S2 — CID 166485129
4-nitro-N-[(3E)-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indol-5-yl]benzenesulfonamide (PubChem CID 166485129) has the molecular formula C19H13N3O5S2 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-nitro-N-[(3E)-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indol-5-yl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[(3E)-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 166485129 |
| Molecular Formula | C19H13N3O5S2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 4-nitro-N-[(3E)-2-oxo-3-(thiophen-2-ylmethylidene)-1H-indol-5-yl]benzenesulfonamide |
| SMILES | O=C1Nc2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2/C1=C\c1cccs1 |
| InChI | InChI=1S/C19H13N3O5S2/c23-19-17(11-14-2-1-9-28-14)16-10-12(3-8-18(16)20-19)21-29(26,27)15-6-4-13(5-7-15)22(24)25/h1-11,21H,(H,20,23)/b17-11+ |
| InChIKey | RITDTUJLJYAZNZ-GZTJUZNOSA-N |
| XLogP | 3.95 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|