C19H16N4O3S — CID 166485124
4-methyl-N-[(3Z)-2-oxo-3-(1H-pyrazol-5-ylmethylidene)-1H-indol-5-yl]benzenesulfonamide (PubChem CID 166485124) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-methyl-N-[(3Z)-2-oxo-3-(1H-pyrazol-5-ylmethylidene)-1H-indol-5-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(3Z)-2-oxo-3-(1H-pyrazol-5-ylmethylidene)-1H-indol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 166485124 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-methyl-N-[(3Z)-2-oxo-3-(1H-pyrazol-5-ylmethylidene)-1H-indol-5-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)/C(=C/c2ccn[nH]2)C(=O)N3)cc1 |
| InChI | InChI=1S/C19H16N4O3S/c1-12-2-5-15(6-3-12)27(25,26)23-14-4-7-18-16(11-14)17(19(24)21-18)10-13-8-9-20-22-13/h2-11,23H,1H3,(H,20,22)(H,21,24)/b17-10- |
| InChIKey | DYGARFGUUQRBEB-YVLHZVERSA-N |
| XLogP | 3.01 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|