C23H16ClN3O3S — CID 91285817
N-(3-chlorophenyl)-3-(1H-indol-2-ylmethylidene)-2-oxo-1H-indole-5-sulfonamide (PubChem CID 91285817) has the molecular formula C23H16ClN3O3S and a molecular weight of 449.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(1H-indol-2-ylmethylidene)-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | N-(3-chlorophenyl)-3-(1H-indol-2-ylmethylidene)-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 91285817 |
| Molecular Formula | C23H16ClN3O3S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | N-(3-chlorophenyl)-3-(1H-indol-2-ylmethylidene)-2-oxo-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Nc3cccc(Cl)c3)cc2C1=Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H16ClN3O3S/c24-15-5-3-6-16(11-15)27-31(29,30)18-8-9-22-19(13-18)20(23(28)26-22)12-17-10-14-4-1-2-7-21(14)25-17/h1-13,25,27H,(H,26,28) |
| InChIKey | SNRCAJYWVSOHOS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|