About CID 73212708
CID 73212708 (PubChem CID 73212708) has the molecular formula C20H18N3O3S
and a molecular weight of 380.45 g/mol.
Molecular Properties
| Compound Name | CID 73212708 |
| PubChem CID | 73212708 |
| Molecular Formula | C20H18N3O3S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)Nc3ccc(S(=O)(=O)N[C]4[CH][CH][CH][CH]4)cc32)[nH]1 |
| InChI | InChI=1S/C20H18N3O3S/c1-12-9-13(2)21-19(12)11-17-16-10-15(7-8-18(16)22-20(17)24)27(25,26)23-14-5-3-4-6-14/h3-11,21,23H,1-2H3,(H,22,24)/b17-11- |
| InChIKey | IQLISACFIJEXLN-BOPFTXTBSA-N |
| XLogP | 2.77 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 73212708 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73212708?
The IUPAC name of CID 73212708 (CID 73212708) is not available.
What is the SMILES notation for CID 73212708?
The canonical SMILES for CID 73212708 is Cc1cc(C)c(/C=C2\C(=O)Nc3ccc(S(=O)(=O)N[C]4[CH][CH][CH][CH]4)cc32)[nH]1.
What is the InChIKey of CID 73212708?
The InChIKey is IQLISACFIJEXLN-BOPFTXTBSA-N. The full InChI is InChI=1S/C20H18N3O3S/c1-12-9-13(2)21-19(12)11-17-16-10-15(7-8-18(16)22-20(17)24)27(25,26)23-14-5-3-4-6-14/h3-11,21,23H,1-2H3,(H,22,24)/b17-11-.
What are the key properties of CID 73212708?
CID 73212708 has a molecular weight of 380.45 g/mol, XLogP of 2.77, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73212708 is sourced from PubChem (CID 73212708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).