C20H18N3O3S — CID 73212708
CID 73212708 (PubChem CID 73212708) has the molecular formula C20H18N3O3S and a molecular weight of 380.45 g/mol.
| Compound Name | CID 73212708 |
|---|---|
| PubChem CID | 73212708 |
| Molecular Formula | C20H18N3O3S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)Nc3ccc(S(=O)(=O)N[C]4[CH][CH][CH][CH]4)cc32)[nH]1 |
| InChI | InChI=1S/C20H18N3O3S/c1-12-9-13(2)21-19(12)11-17-16-10-15(7-8-18(16)22-20(17)24)27(25,26)23-14-5-3-4-6-14/h3-11,21,23H,1-2H3,(H,22,24)/b17-11- |
| InChIKey | IQLISACFIJEXLN-BOPFTXTBSA-N |
| XLogP | 2.77 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|