C18H15Br2NO4 — CID 57016715
5,7-dibromo-3-[(2,3,4-trimethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 57016715) has the molecular formula C18H15Br2NO4 and a molecular weight of 469.13 g/mol. Its IUPAC name is 5,7-dibromo-3-[(2,3,4-trimethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 5,7-dibromo-3-[(2,3,4-trimethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57016715 |
| Molecular Formula | C18H15Br2NO4 |
| Molecular Weight | 469.13 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | 5,7-dibromo-3-[(2,3,4-trimethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1ccc(C=C2C(=O)Nc3c(Br)cc(Br)cc32)c(OC)c1OC |
| InChI | InChI=1S/C18H15Br2NO4/c1-23-14-5-4-9(16(24-2)17(14)25-3)6-12-11-7-10(19)8-13(20)15(11)21-18(12)22/h4-8H,1-3H3,(H,21,22) |
| InChIKey | GDAIFNONGVMGBE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.13 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|