C17H13Br2NO4 — CID 3379285
3-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one (PubChem CID 3379285) has the molecular formula C17H13Br2NO4 and a molecular weight of 455.10 g/mol. Its IUPAC name is 3-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one.
| Compound Name | 3-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 3379285 |
| Molecular Formula | C17H13Br2NO4 |
| Molecular Weight | 455.10 g/mol |
| Exact Mass | 452.92 |
| IUPAC Name | 3-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
| SMILES | COc1cc2c(cc1OC)C(=Cc1cc(Br)cc(Br)c1O)C(=O)N2 |
| InChI | InChI=1S/C17H13Br2NO4/c1-23-14-6-10-11(17(22)20-13(10)7-15(14)24-2)4-8-3-9(18)5-12(19)16(8)21/h3-7,21H,1-2H3,(H,20,22) |
| InChIKey | QJWQUOWCPIWACU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.10 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|