C18H16N2O7 — CID 6889590
(3Z)-3-[(2-hydroxy-5-methoxy-3-nitrophenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one (PubChem CID 6889590) has the molecular formula C18H16N2O7 and a molecular weight of 372.33 g/mol. Its IUPAC name is (3Z)-3-[(2-hydroxy-5-methoxy-3-nitrophenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one.
| Compound Name | (3Z)-3-[(2-hydroxy-5-methoxy-3-nitrophenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 6889590 |
| Molecular Formula | C18H16N2O7 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (3Z)-3-[(2-hydroxy-5-methoxy-3-nitrophenyl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3cc(OC)c(OC)cc32)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N2O7/c1-25-10-4-9(17(21)14(6-10)20(23)24)5-12-11-7-15(26-2)16(27-3)8-13(11)19-18(12)22/h4-8,21H,1-3H3,(H,19,22)/b12-5- |
| InChIKey | BZYDKSARHDTWEE-XGICHPGQSA-N |
| XLogP | 2.82 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|