C21H16N2O6 — CID 6889422
(3E)-3-[(2-hydroxy-6-nitronaphthalen-1-yl)methylidene]-5,6-dimethoxy-1H-indol-2-one (PubChem CID 6889422) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is (3E)-3-[(2-hydroxy-6-nitronaphthalen-1-yl)methylidene]-5,6-dimethoxy-1H-indol-2-one.
| Compound Name | (3E)-3-[(2-hydroxy-6-nitronaphthalen-1-yl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 6889422 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (3E)-3-[(2-hydroxy-6-nitronaphthalen-1-yl)methylidene]-5,6-dimethoxy-1H-indol-2-one |
| SMILES | COc1cc2c(cc1OC)/C(=C\c1c(O)ccc3cc([N+](=O)[O-])ccc13)C(=O)N2 |
| InChI | InChI=1S/C21H16N2O6/c1-28-19-9-14-16(21(25)22-17(14)10-20(19)29-2)8-15-13-5-4-12(23(26)27)7-11(13)3-6-18(15)24/h3-10,24H,1-2H3,(H,22,25)/b16-8+ |
| InChIKey | GNRXJDLMHDXJHZ-LZYBPNLTSA-N |
| XLogP | 3.96 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|