C15H9ClN2O4 — CID 6363126
(3E)-3-[(5-chloro-2-hydroxy-3-nitrophenyl)methylidene]-1H-indol-2-one (PubChem CID 6363126) has the molecular formula C15H9ClN2O4 and a molecular weight of 316.70 g/mol. Its IUPAC name is (3E)-3-[(5-chloro-2-hydroxy-3-nitrophenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[(5-chloro-2-hydroxy-3-nitrophenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 6363126 |
| Molecular Formula | C15H9ClN2O4 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (3E)-3-[(5-chloro-2-hydroxy-3-nitrophenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C\c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C15H9ClN2O4/c16-9-5-8(14(19)13(7-9)18(21)22)6-11-10-3-1-2-4-12(10)17-15(11)20/h1-7,19H,(H,17,20)/b11-6+ |
| InChIKey | PUTSWYWHAIOCEW-IZZDOVSWSA-N |
| XLogP | 3.45 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|