C23H12ClIN4O4 — CID 4978506
3-(4-chloro-2-nitrophenyl)-6-iodo-2-[(2-oxo-1H-indol-3-ylidene)methyl]quinazolin-4-one (PubChem CID 4978506) has the molecular formula C23H12ClIN4O4 and a molecular weight of 570.73 g/mol. Its IUPAC name is 3-(4-chloro-2-nitrophenyl)-6-iodo-2-[(2-oxo-1H-indol-3-ylidene)methyl]quinazolin-4-one.
| Compound Name | 3-(4-chloro-2-nitrophenyl)-6-iodo-2-[(2-oxo-1H-indol-3-ylidene)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4978506 |
| Molecular Formula | C23H12ClIN4O4 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 569.96 |
| IUPAC Name | 3-(4-chloro-2-nitrophenyl)-6-iodo-2-[(2-oxo-1H-indol-3-ylidene)methyl]quinazolin-4-one |
| SMILES | O=C1Nc2ccccc2C1=Cc1nc2ccc(I)cc2c(=O)n1-c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H12ClIN4O4/c24-12-5-8-19(20(9-12)29(32)33)28-21(26-18-7-6-13(25)10-16(18)23(28)31)11-15-14-3-1-2-4-17(14)27-22(15)30/h1-11H,(H,27,30) |
| InChIKey | ZKFDPOXQXLLKNI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|