C22H12Cl2IN3O3 — CID 6238098
3-(2,4-dichlorophenyl)-6-iodo-2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-one (PubChem CID 6238098) has the molecular formula C22H12Cl2IN3O3 and a molecular weight of 564.17 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-6-iodo-2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-one.
| Compound Name | 3-(2,4-dichlorophenyl)-6-iodo-2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 6238098 |
| Molecular Formula | C22H12Cl2IN3O3 |
| Molecular Weight | 564.17 g/mol |
| Exact Mass | 562.93 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-6-iodo-2-[(E)-2-(4-nitrophenyl)ethenyl]quinazolin-4-one |
| SMILES | O=c1c2cc(I)ccc2nc(/C=C/c2ccc([N+](=O)[O-])cc2)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H12Cl2IN3O3/c23-14-4-9-20(18(24)11-14)27-21(10-3-13-1-6-16(7-2-13)28(30)31)26-19-8-5-15(25)12-17(19)22(27)29/h1-12H/b10-3+ |
| InChIKey | FXKSHPPPZXGTLA-XCVCLJGOSA-N |
| XLogP | 6.38 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.17 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|