C23H13ClIN3O5 — CID 6035482
2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-(2-chloro-4-nitrophenyl)-6-iodoquinazolin-4-one (PubChem CID 6035482) has the molecular formula C23H13ClIN3O5 and a molecular weight of 573.73 g/mol. Its IUPAC name is 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-(2-chloro-4-nitrophenyl)-6-iodoquinazolin-4-one.
| Compound Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-(2-chloro-4-nitrophenyl)-6-iodoquinazolin-4-one |
|---|---|
| PubChem CID | 6035482 |
| Molecular Formula | C23H13ClIN3O5 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 572.96 |
| IUPAC Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-(2-chloro-4-nitrophenyl)-6-iodoquinazolin-4-one |
| SMILES | O=c1c2cc(I)ccc2nc(/C=C/c2ccc3c(c2)OCO3)n1-c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H13ClIN3O5/c24-17-11-15(28(30)31)4-6-19(17)27-22(26-18-5-3-14(25)10-16(18)23(27)29)8-2-13-1-7-20-21(9-13)33-12-32-20/h1-11H,12H2/b8-2+ |
| InChIKey | CJXGFPGHPPMZJY-KRXBUXKQSA-N |
| XLogP | 5.45 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|