C23H16ClIN2O3 — CID 3737871
3-(2-chlorophenyl)-2-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-iodoquinazolin-4-one (PubChem CID 3737871) has the molecular formula C23H16ClIN2O3 and a molecular weight of 530.75 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-iodoquinazolin-4-one.
| Compound Name | 3-(2-chlorophenyl)-2-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-iodoquinazolin-4-one |
|---|---|
| PubChem CID | 3737871 |
| Molecular Formula | C23H16ClIN2O3 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | 3-(2-chlorophenyl)-2-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-iodoquinazolin-4-one |
| SMILES | COc1cc(C=Cc2nc3ccc(I)cc3c(=O)n2-c2ccccc2Cl)ccc1O |
| InChI | InChI=1S/C23H16ClIN2O3/c1-30-21-12-14(6-10-20(21)28)7-11-22-26-18-9-8-15(25)13-16(18)23(29)27(22)19-5-3-2-4-17(19)24/h2-13,28H,1H3 |
| InChIKey | UULOPHFJLMNOFM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|