C24H17ClIN3O5 — CID 6230827
3-(4-chloro-2-nitrophenyl)-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-6-iodoquinazolin-4-one (PubChem CID 6230827) has the molecular formula C24H17ClIN3O5 and a molecular weight of 589.77 g/mol. Its IUPAC name is 3-(4-chloro-2-nitrophenyl)-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-6-iodoquinazolin-4-one.
| Compound Name | 3-(4-chloro-2-nitrophenyl)-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-6-iodoquinazolin-4-one |
|---|---|
| PubChem CID | 6230827 |
| Molecular Formula | C24H17ClIN3O5 |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 588.99 |
| IUPAC Name | 3-(4-chloro-2-nitrophenyl)-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-6-iodoquinazolin-4-one |
| SMILES | COc1ccc(/C=C/c2nc3ccc(I)cc3c(=O)n2-c2ccc(Cl)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H17ClIN3O5/c1-33-21-9-3-14(11-22(21)34-2)4-10-23-27-18-7-6-16(26)13-17(18)24(30)28(23)19-8-5-15(25)12-20(19)29(31)32/h3-13H,1-2H3/b10-4+ |
| InChIKey | DYPKXSBWRUNVFL-ONNFQVAWSA-N |
| XLogP | 5.74 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|