C25H22N4O — CID 143823074
(3E)-3-[[3-amino-4-[(E)-3-pyridin-4-ylprop-2-enimidoyl]phenyl]methylidene]-5-ethyl-1H-indol-2-one (PubChem CID 143823074) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is (3E)-3-[[3-amino-4-[(E)-3-pyridin-4-ylprop-2-enimidoyl]phenyl]methylidene]-5-ethyl-1H-indol-2-one.
| Compound Name | (3E)-3-[[3-amino-4-[(E)-3-pyridin-4-ylprop-2-enimidoyl]phenyl]methylidene]-5-ethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 143823074 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (3E)-3-[[3-amino-4-[(E)-3-pyridin-4-ylprop-2-enimidoyl]phenyl]methylidene]-5-ethyl-1H-indol-2-one |
| SMILES | [H]/N=C(\C=C\c1ccncc1)c1ccc(/C=C2/C(=O)Nc3ccc(CC)cc32)cc1N |
| InChI | InChI=1S/C25H22N4O/c1-2-16-5-8-24-20(13-16)21(25(30)29-24)14-18-3-6-19(23(27)15-18)22(26)7-4-17-9-11-28-12-10-17/h3-15,26H,2,27H2,1H3,(H,29,30)/b7-4+,21-14+,26-22+ |
| InChIKey | FLXMRNSETOTTMB-OADYGXSSSA-N |
| XLogP | 4.80 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|