C21H23NO — CID 57269409
5-ethyl-3-[(3-methyl-4,5,6,7-tetrahydro-1H-inden-2-yl)methylidene]-1H-indol-2-one (PubChem CID 57269409) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is 5-ethyl-3-[(3-methyl-4,5,6,7-tetrahydro-1H-inden-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | 5-ethyl-3-[(3-methyl-4,5,6,7-tetrahydro-1H-inden-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 57269409 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 5-ethyl-3-[(3-methyl-4,5,6,7-tetrahydro-1H-inden-2-yl)methylidene]-1H-indol-2-one |
| SMILES | CCc1ccc2c(c1)C(=CC1=C(C)C3=C(CCCC3)C1)C(=O)N2 |
| InChI | InChI=1S/C21H23NO/c1-3-14-8-9-20-18(10-14)19(21(23)22-20)12-16-11-15-6-4-5-7-17(15)13(16)2/h8-10,12H,3-7,11H2,1-2H3,(H,22,23) |
| InChIKey | GAEJFWSNGCRXCK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|