C19H16F3NO — CID 57074077
3-(4,5,6,7-tetrahydro-1H-inden-2-ylmethylidene)-5-(trifluoromethyl)-1H-indol-2-one (PubChem CID 57074077) has the molecular formula C19H16F3NO and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydro-1H-inden-2-ylmethylidene)-5-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-(4,5,6,7-tetrahydro-1H-inden-2-ylmethylidene)-5-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 57074077 |
| Molecular Formula | C19H16F3NO |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-(4,5,6,7-tetrahydro-1H-inden-2-ylmethylidene)-5-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(C(F)(F)F)cc2C1=CC1=CC2=C(CCCC2)C1 |
| InChI | InChI=1S/C19H16F3NO/c20-19(21,22)14-5-6-17-15(10-14)16(18(24)23-17)9-11-7-12-3-1-2-4-13(12)8-11/h5-7,9-10H,1-4,8H2,(H,23,24) |
| InChIKey | IRQKAHGHWQCBAH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|