C18H15F3N2O — CID 57186205
3-(4,5,6,7-tetrahydro-1H-indol-3-ylmethylidene)-5-(trifluoromethyl)-1H-indol-2-one (PubChem CID 57186205) has the molecular formula C18H15F3N2O and a molecular weight of 332.33 g/mol. Its IUPAC name is 3-(4,5,6,7-tetrahydro-1H-indol-3-ylmethylidene)-5-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3-(4,5,6,7-tetrahydro-1H-indol-3-ylmethylidene)-5-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 57186205 |
| Molecular Formula | C18H15F3N2O |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 3-(4,5,6,7-tetrahydro-1H-indol-3-ylmethylidene)-5-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(C(F)(F)F)cc2C1=Cc1c[nH]c2c1CCCC2 |
| InChI | InChI=1S/C18H15F3N2O/c19-18(20,21)11-5-6-16-13(8-11)14(17(24)23-16)7-10-9-22-15-4-2-1-3-12(10)15/h5-9,22H,1-4H2,(H,23,24) |
| InChIKey | QEIXEZFSAHQQGB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|