C20H13F3N2O — CID 2741734
3-[[1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]-1H-indol-2-one (PubChem CID 2741734) has the molecular formula C20H13F3N2O and a molecular weight of 354.33 g/mol. Its IUPAC name is 3-[[1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | 3-[[1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 2741734 |
| Molecular Formula | C20H13F3N2O |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 3-[[1-[4-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2C1=Cc1cccn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H13F3N2O/c21-20(22,23)13-7-9-14(10-8-13)25-11-3-4-15(25)12-17-16-5-1-2-6-18(16)24-19(17)26/h1-12H,(H,24,26) |
| InChIKey | DHCUSFXCBZAYRM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_K(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|