C19H18INO — CID 57210180
5-iodo-4-methyl-3-(4,5,6,7-tetrahydro-1H-inden-2-ylmethylidene)-1H-indol-2-one (PubChem CID 57210180) has the molecular formula C19H18INO and a molecular weight of 403.26 g/mol. Its IUPAC name is 5-iodo-4-methyl-3-(4,5,6,7-tetrahydro-1H-inden-2-ylmethylidene)-1H-indol-2-one.
| Compound Name | 5-iodo-4-methyl-3-(4,5,6,7-tetrahydro-1H-inden-2-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 57210180 |
| Molecular Formula | C19H18INO |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 5-iodo-4-methyl-3-(4,5,6,7-tetrahydro-1H-inden-2-ylmethylidene)-1H-indol-2-one |
| SMILES | Cc1c(I)ccc2c1C(=CC1=CC3=C(CCCC3)C1)C(=O)N2 |
| InChI | InChI=1S/C19H18INO/c1-11-16(20)6-7-17-18(11)15(19(22)21-17)10-12-8-13-4-2-3-5-14(13)9-12/h6-8,10H,2-5,9H2,1H3,(H,21,22) |
| InChIKey | NMQKQKOXSKDPGX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|